C26H32N4O5S — CID 162663468
4-[4-(5,7-dimethoxy-4-thiomorpholin-4-ylquinazolin-2-yl)-2,6-dimethylphenoxy]-N-hydroxybutanamide (PubChem CID 162663468) has the molecular formula C26H32N4O5S and a molecular weight of 512.63 g/mol. Its IUPAC name is 4-[4-(5,7-dimethoxy-4-thiomorpholin-4-ylquinazolin-2-yl)-2,6-dimethylphenoxy]-N-hydroxybutanamide.
| Compound Name | 4-[4-(5,7-dimethoxy-4-thiomorpholin-4-ylquinazolin-2-yl)-2,6-dimethylphenoxy]-N-hydroxybutanamide |
|---|---|
| PubChem CID | 162663468 |
| Molecular Formula | C26H32N4O5S |
| Molecular Weight | 512.63 g/mol |
| Exact Mass | 512.21 |
| IUPAC Name | 4-[4-(5,7-dimethoxy-4-thiomorpholin-4-ylquinazolin-2-yl)-2,6-dimethylphenoxy]-N-hydroxybutanamide |
| SMILES | COc1cc(OC)c2c(N3CCSCC3)nc(-c3cc(C)c(OCCCC(=O)NO)c(C)c3)nc2c1 |
| InChI | InChI=1S/C26H32N4O5S/c1-16-12-18(13-17(2)24(16)35-9-5-6-22(31)29-32)25-27-20-14-19(33-3)15-21(34-4)23(20)26(28-25)30-7-10-36-11-8-30/h12-15,32H,5-11H2,1-4H3,(H,29,31) |
| InChIKey | MIOZVZXMDSXPLF-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 106.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.63 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|