C16H29N3O2 — CID 162663477
3-imidazol-1-yl-N-[[(2R,3R)-2-methoxy-2,5,5-trimethyloxan-3-yl]methyl]propan-1-amine (PubChem CID 162663477) has the molecular formula C16H29N3O2 and a molecular weight of 295.43 g/mol. Its IUPAC name is 3-imidazol-1-yl-N-[[(2R,3R)-2-methoxy-2,5,5-trimethyloxan-3-yl]methyl]propan-1-amine.
| Compound Name | 3-imidazol-1-yl-N-[[(2R,3R)-2-methoxy-2,5,5-trimethyloxan-3-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 162663477 |
| Molecular Formula | C16H29N3O2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | 3-imidazol-1-yl-N-[[(2R,3R)-2-methoxy-2,5,5-trimethyloxan-3-yl]methyl]propan-1-amine |
| SMILES | CO[C@]1(C)OCC(C)(C)C[C@@H]1CNCCCn1ccnc1 |
| InChI | InChI=1S/C16H29N3O2/c1-15(2)10-14(16(3,20-4)21-12-15)11-17-6-5-8-19-9-7-18-13-19/h7,9,13-14,17H,5-6,8,10-12H2,1-4H3/t14-,16-/m1/s1 |
| InChIKey | MIKMXOCIVOPOJS-GDBMZVCRSA-N |
| XLogP | 2.29 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|