About 3-[[3-(4-phenylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3H-2-benzofuran-1-one
3-[[3-(4-phenylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3H-2-benzofuran-1-one (PubChem CID 162663567) has the molecular formula C23H16N2O3
and a molecular weight of 368.39 g/mol. Its IUPAC name is 3-[[3-(4-phenylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3H-2-benzofuran-1-one.
Molecular Properties
| Compound Name | 3-[[3-(4-phenylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3H-2-benzofuran-1-one |
| PubChem CID | 162663567 |
| Molecular Formula | C23H16N2O3 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 3-[[3-(4-phenylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3H-2-benzofuran-1-one |
| SMILES | O=C1OC(Cc2nc(-c3ccc(-c4ccccc4)cc3)no2)c2ccccc21 |
| InChI | InChI=1S/C23H16N2O3/c26-23-19-9-5-4-8-18(19)20(27-23)14-21-24-22(25-28-21)17-12-10-16(11-13-17)15-6-2-1-3-7-15/h1-13,20H,14H2 |
| InChIKey | XDBUZXRMYQCNQR-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[[3-(4-phenylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3H-2-benzofuran-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[3-(4-phenylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3H-2-benzofuran-1-one?
The IUPAC name of 3-[[3-(4-phenylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3H-2-benzofuran-1-one (CID 162663567) is 3-[[3-(4-phenylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3H-2-benzofuran-1-one.
What is the SMILES notation for 3-[[3-(4-phenylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3H-2-benzofuran-1-one?
The canonical SMILES for 3-[[3-(4-phenylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3H-2-benzofuran-1-one is O=C1OC(Cc2nc(-c3ccc(-c4ccccc4)cc3)no2)c2ccccc21.
What is the InChIKey of 3-[[3-(4-phenylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3H-2-benzofuran-1-one?
The InChIKey is XDBUZXRMYQCNQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H16N2O3/c26-23-19-9-5-4-8-18(19)20(27-23)14-21-24-22(25-28-21)17-12-10-16(11-13-17)15-6-2-1-3-7-15/h1-13,20H,14H2.
What are the key properties of 3-[[3-(4-phenylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3H-2-benzofuran-1-one?
3-[[3-(4-phenylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3H-2-benzofuran-1-one has a molecular weight of 368.39 g/mol, XLogP of 4.86, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[3-(4-phenylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3H-2-benzofuran-1-one is sourced from PubChem (CID 162663567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).