C20H26O5 — CID 162663773
4-[2-[(6R,8aR)-4,6-dihydroxy-2,5,5,8a-tetramethyl-3-oxo-7,8-dihydro-6H-naphthalen-1-yl]ethyl]-2H-furan-5-one (PubChem CID 162663773) has the molecular formula C20H26O5 and a molecular weight of 346.42 g/mol. Its IUPAC name is 4-[2-[(6R,8aR)-4,6-dihydroxy-2,5,5,8a-tetramethyl-3-oxo-7,8-dihydro-6H-naphthalen-1-yl]ethyl]-2H-furan-5-one.
| Compound Name | 4-[2-[(6R,8aR)-4,6-dihydroxy-2,5,5,8a-tetramethyl-3-oxo-7,8-dihydro-6H-naphthalen-1-yl]ethyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 162663773 |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 4-[2-[(6R,8aR)-4,6-dihydroxy-2,5,5,8a-tetramethyl-3-oxo-7,8-dihydro-6H-naphthalen-1-yl]ethyl]-2H-furan-5-one |
| SMILES | CC1=C(CCC2=CCOC2=O)[C@@]2(C)CC[C@@H](O)C(C)(C)C2=C(O)C1=O |
| InChI | InChI=1S/C20H26O5/c1-11-13(6-5-12-8-10-25-18(12)24)20(4)9-7-14(21)19(2,3)17(20)16(23)15(11)22/h8,14,21,23H,5-7,9-10H2,1-4H3/t14-,20-/m1/s1 |
| InChIKey | PYSBNCLKMCAVGP-JLTOFOAXSA-N |
| XLogP | 3.15 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |