C28H45F3O3 — CID 162663790
(3S,7S,8S,9S,10R,13R,14S,17R)-17-[(2R)-6-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-7-(trifluoromethyl)-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,7-diol (PubChem CID 162663790) has the molecular formula C28H45F3O3 and a molecular weight of 486.66 g/mol. Its IUPAC name is (3S,7S,8S,9S,10R,13R,14S,17R)-17-[(2R)-6-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-7-(trifluoromethyl)-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,7-diol.
| Compound Name | (3S,7S,8S,9S,10R,13R,14S,17R)-17-[(2R)-6-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-7-(trifluoromethyl)-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,7-diol |
|---|---|
| PubChem CID | 162663790 |
| Molecular Formula | C28H45F3O3 |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.33 |
| IUPAC Name | (3S,7S,8S,9S,10R,13R,14S,17R)-17-[(2R)-6-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-7-(trifluoromethyl)-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,7-diol |
| SMILES | C[C@H](CCCC(C)(C)O)[C@H]1CC[C@H]2[C@H]3[C@H](CC[C@]12C)[C@@]1(C)CC[C@H](O)CC1=C[C@]3(O)C(F)(F)F |
| InChI | InChI=1S/C28H45F3O3/c1-17(7-6-12-24(2,3)33)20-8-9-21-23-22(11-14-26(20,21)5)25(4)13-10-19(32)15-18(25)16-27(23,34)28(29,30)31/h16-17,19-23,32-34H,6-15H2,1-5H3/t17-,19+,20-,21+,22+,23+,25+,26-,27-/m1/s1 |
| InChIKey | SKKRJIZEQTTZMZ-SGYUKASKSA-N |
| XLogP | 6.41 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|