C25H29F4N5O — CID 162663818
(6S,8R)-6-[5-[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]oxy-2-pyridinyl]-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinoline (PubChem CID 162663818) has the molecular formula C25H29F4N5O and a molecular weight of 491.53 g/mol. Its IUPAC name is (6S,8R)-6-[5-[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]oxy-2-pyridinyl]-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinoline.
| Compound Name | (6S,8R)-6-[5-[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]oxy-2-pyridinyl]-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinoline |
|---|---|
| PubChem CID | 162663818 |
| Molecular Formula | C25H29F4N5O |
| Molecular Weight | 491.53 g/mol |
| Exact Mass | 491.23 |
| IUPAC Name | (6S,8R)-6-[5-[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]oxy-2-pyridinyl]-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinoline |
| SMILES | C[C@@H]1Cc2c(ccc3[nH]ncc23)[C@@H](c2ccc(O[C@H]3CCN(CCCF)C3)cn2)N1CC(F)(F)F |
| InChI | InChI=1S/C25H29F4N5O/c1-16-11-20-19(4-6-22-21(20)13-31-32-22)24(34(16)15-25(27,28)29)23-5-3-17(12-30-23)35-18-7-10-33(14-18)9-2-8-26/h3-6,12-13,16,18,24H,2,7-11,14-15H2,1H3,(H,31,32)/t16-,18+,24+/m1/s1 |
| InChIKey | FXESDNFFQIPNSO-YLNUKYHNSA-N |
| XLogP | 4.67 |
| TPSA | 57.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.53 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |