C21H34N6O5S — CID 162664056
(2S)-6-amino-2-[[(8R,11S)-2,9-dioxo-11-propan-2-yl-13-thia-3,10,15-triazabicyclo[10.2.1]pentadeca-1(14),12(15)-dien-8-yl]carbamoylamino]hexanoic acid (PubChem CID 162664056) has the molecular formula C21H34N6O5S and a molecular weight of 482.61 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(8R,11S)-2,9-dioxo-11-propan-2-yl-13-thia-3,10,15-triazabicyclo[10.2.1]pentadeca-1(14),12(15)-dien-8-yl]carbamoylamino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(8R,11S)-2,9-dioxo-11-propan-2-yl-13-thia-3,10,15-triazabicyclo[10.2.1]pentadeca-1(14),12(15)-dien-8-yl]carbamoylamino]hexanoic acid |
|---|---|
| PubChem CID | 162664056 |
| Molecular Formula | C21H34N6O5S |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | (2S)-6-amino-2-[[(8R,11S)-2,9-dioxo-11-propan-2-yl-13-thia-3,10,15-triazabicyclo[10.2.1]pentadeca-1(14),12(15)-dien-8-yl]carbamoylamino]hexanoic acid |
| SMILES | CC(C)[C@@H]1NC(=O)[C@H](NC(=O)N[C@@H](CCCCN)C(=O)O)CCCCNC(=O)c2csc1n2 |
| InChI | InChI=1S/C21H34N6O5S/c1-12(2)16-19-24-15(11-33-19)17(28)23-10-6-4-7-13(18(29)27-16)25-21(32)26-14(20(30)31)8-3-5-9-22/h11-14,16H,3-10,22H2,1-2H3,(H,23,28)(H,27,29)(H,30,31)(H2,25,26,32)/t13-,14+,16+/m1/s1 |
| InChIKey | ZCHNTIJYUMFUTH-YCPHGPKFSA-N |
| XLogP | 1.12 |
| TPSA | 175.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|