C16H11BF2N2O — CID 162664061
4-(2,2-difluoro-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)benzaldehyde (PubChem CID 162664061) has the molecular formula C16H11BF2N2O and a molecular weight of 296.09 g/mol. Its IUPAC name is 4-(2,2-difluoro-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)benzaldehyde.
| Compound Name | 4-(2,2-difluoro-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)benzaldehyde |
|---|---|
| PubChem CID | 162664061 |
| Molecular Formula | C16H11BF2N2O |
| Molecular Weight | 296.09 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 4-(2,2-difluoro-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)benzaldehyde |
| SMILES | O=Cc1ccc(C2=C3C=CC=[N+]3[B-](F)(F)n3cccc32)cc1 |
| InChI | InChI=1S/C16H11BF2N2O/c18-17(19)20-9-1-3-14(20)16(15-4-2-10-21(15)17)13-7-5-12(11-22)6-8-13/h1-11H |
| InChIKey | XHGUJFRRZWFPER-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 25.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.09 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|