C33H32ClN3O3 — CID 162664062
4-[[(7-chloro-15-methyl-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,14-hexaen-3-yl)amino]methyl]-N-[(4-hydroxy-3-methoxyphenyl)methyl]benzamide (PubChem CID 162664062) has the molecular formula C33H32ClN3O3 and a molecular weight of 554.09 g/mol. Its IUPAC name is 4-[[(7-chloro-15-methyl-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,14-hexaen-3-yl)amino]methyl]-N-[(4-hydroxy-3-methoxyphenyl)methyl]benzamide.
| Compound Name | 4-[[(7-chloro-15-methyl-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,14-hexaen-3-yl)amino]methyl]-N-[(4-hydroxy-3-methoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 162664062 |
| Molecular Formula | C33H32ClN3O3 |
| Molecular Weight | 554.09 g/mol |
| Exact Mass | 553.21 |
| IUPAC Name | 4-[[(7-chloro-15-methyl-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,14-hexaen-3-yl)amino]methyl]-N-[(4-hydroxy-3-methoxyphenyl)methyl]benzamide |
| SMILES | COc1cc(CNC(=O)c2ccc(CNc3c4c(nc5cc(Cl)ccc35)CC3C=C(C)CC4C3)cc2)ccc1O |
| InChI | InChI=1S/C33H32ClN3O3/c1-19-11-22-13-24(12-19)31-28(14-22)37-27-16-25(34)8-9-26(27)32(31)35-17-20-3-6-23(7-4-20)33(39)36-18-21-5-10-29(38)30(15-21)40-2/h3-11,15-16,22,24,38H,12-14,17-18H2,1-2H3,(H,35,37)(H,36,39) |
| InChIKey | JAUVXAJRIZCOSF-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.09 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|