C27H25F3N6OS2 — CID 162664189
N-[(Z)-[1-[1-ethyl-5-[4-(morpholin-4-ylmethyl)-1,3-thiazol-2-yl]indol-3-yl]-2,2,2-trifluoroethylidene]amino]-1,3-benzothiazol-2-amine (PubChem CID 162664189) has the molecular formula C27H25F3N6OS2 and a molecular weight of 570.67 g/mol. Its IUPAC name is N-[(Z)-[1-[1-ethyl-5-[4-(morpholin-4-ylmethyl)-1,3-thiazol-2-yl]indol-3-yl]-2,2,2-trifluoroethylidene]amino]-1,3-benzothiazol-2-amine.
| Compound Name | N-[(Z)-[1-[1-ethyl-5-[4-(morpholin-4-ylmethyl)-1,3-thiazol-2-yl]indol-3-yl]-2,2,2-trifluoroethylidene]amino]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 162664189 |
| Molecular Formula | C27H25F3N6OS2 |
| Molecular Weight | 570.67 g/mol |
| Exact Mass | 570.15 |
| IUPAC Name | N-[(Z)-[1-[1-ethyl-5-[4-(morpholin-4-ylmethyl)-1,3-thiazol-2-yl]indol-3-yl]-2,2,2-trifluoroethylidene]amino]-1,3-benzothiazol-2-amine |
| SMILES | CCn1cc(/C(=N/Nc2nc3ccccc3s2)C(F)(F)F)c2cc(-c3nc(CN4CCOCC4)cs3)ccc21 |
| InChI | InChI=1S/C27H25F3N6OS2/c1-2-36-15-20(24(27(28,29)30)33-34-26-32-21-5-3-4-6-23(21)39-26)19-13-17(7-8-22(19)36)25-31-18(16-38-25)14-35-9-11-37-12-10-35/h3-8,13,15-16H,2,9-12,14H2,1H3,(H,32,34)/b33-24- |
| InChIKey | LFJVYRGVJWCQKX-GIBOGKFOSA-N |
| XLogP | 6.61 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.67 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|