About 4'-(4-methylsulfonylphenyl)-3'-phenylspiro[3H-indene-2,5'-4H-1,2-oxazole]-1-one
4'-(4-methylsulfonylphenyl)-3'-phenylspiro[3H-indene-2,5'-4H-1,2-oxazole]-1-one (PubChem CID 162664224) has the molecular formula C24H19NO4S
and a molecular weight of 417.49 g/mol. Its IUPAC name is 4'-(4-methylsulfonylphenyl)-3'-phenylspiro[3H-indene-2,5'-4H-1,2-oxazole]-1-one.
Molecular Properties
| Compound Name | 4'-(4-methylsulfonylphenyl)-3'-phenylspiro[3H-indene-2,5'-4H-1,2-oxazole]-1-one |
| PubChem CID | 162664224 |
| Molecular Formula | C24H19NO4S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | 4'-(4-methylsulfonylphenyl)-3'-phenylspiro[3H-indene-2,5'-4H-1,2-oxazole]-1-one |
| SMILES | CS(=O)(=O)c1ccc(C2C(c3ccccc3)=NOC23Cc2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C24H19NO4S/c1-30(27,28)19-13-11-16(12-14-19)21-22(17-7-3-2-4-8-17)25-29-24(21)15-18-9-5-6-10-20(18)23(24)26/h2-14,21H,15H2,1H3 |
| InChIKey | LXPJJFLQNSDWPH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4'-(4-methylsulfonylphenyl)-3'-phenylspiro[3H-indene-2,5'-4H-1,2-oxazole]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4'-(4-methylsulfonylphenyl)-3'-phenylspiro[3H-indene-2,5'-4H-1,2-oxazole]-1-one?
The IUPAC name of 4'-(4-methylsulfonylphenyl)-3'-phenylspiro[3H-indene-2,5'-4H-1,2-oxazole]-1-one (CID 162664224) is 4'-(4-methylsulfonylphenyl)-3'-phenylspiro[3H-indene-2,5'-4H-1,2-oxazole]-1-one.
What is the SMILES notation for 4'-(4-methylsulfonylphenyl)-3'-phenylspiro[3H-indene-2,5'-4H-1,2-oxazole]-1-one?
The canonical SMILES for 4'-(4-methylsulfonylphenyl)-3'-phenylspiro[3H-indene-2,5'-4H-1,2-oxazole]-1-one is CS(=O)(=O)c1ccc(C2C(c3ccccc3)=NOC23Cc2ccccc2C3=O)cc1.
What is the InChIKey of 4'-(4-methylsulfonylphenyl)-3'-phenylspiro[3H-indene-2,5'-4H-1,2-oxazole]-1-one?
The InChIKey is LXPJJFLQNSDWPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19NO4S/c1-30(27,28)19-13-11-16(12-14-19)21-22(17-7-3-2-4-8-17)25-29-24(21)15-18-9-5-6-10-20(18)23(24)26/h2-14,21H,15H2,1H3.
What are the key properties of 4'-(4-methylsulfonylphenyl)-3'-phenylspiro[3H-indene-2,5'-4H-1,2-oxazole]-1-one?
4'-(4-methylsulfonylphenyl)-3'-phenylspiro[3H-indene-2,5'-4H-1,2-oxazole]-1-one has a molecular weight of 417.49 g/mol, XLogP of 3.79, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4'-(4-methylsulfonylphenyl)-3'-phenylspiro[3H-indene-2,5'-4H-1,2-oxazole]-1-one is sourced from PubChem (CID 162664224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).