About N-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-7-yl)-N-propylsulfonylpropane-1-sulfonamide
N-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-7-yl)-N-propylsulfonylpropane-1-sulfonamide (PubChem CID 162664328) has the molecular formula C16H26N2O6S3
and a molecular weight of 438.59 g/mol. Its IUPAC name is N-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-7-yl)-N-propylsulfonylpropane-1-sulfonamide.
Molecular Properties
| Compound Name | N-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-7-yl)-N-propylsulfonylpropane-1-sulfonamide |
| PubChem CID | 162664328 |
| Molecular Formula | C16H26N2O6S3 |
| Molecular Weight | 438.59 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | N-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-7-yl)-N-propylsulfonylpropane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)N(c1ccc2c(c1)N(S(C)(=O)=O)CCC2)S(=O)(=O)CCC |
| InChI | InChI=1S/C16H26N2O6S3/c1-4-11-26(21,22)18(27(23,24)12-5-2)15-9-8-14-7-6-10-17(16(14)13-15)25(3,19)20/h8-9,13H,4-7,10-12H2,1-3H3 |
| InChIKey | DPNPDANNXCXTCA-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 108.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.59 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-7-yl)-N-propylsulfonylpropane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-7-yl)-N-propylsulfonylpropane-1-sulfonamide?
The IUPAC name of N-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-7-yl)-N-propylsulfonylpropane-1-sulfonamide (CID 162664328) is N-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-7-yl)-N-propylsulfonylpropane-1-sulfonamide.
What is the SMILES notation for N-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-7-yl)-N-propylsulfonylpropane-1-sulfonamide?
The canonical SMILES for N-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-7-yl)-N-propylsulfonylpropane-1-sulfonamide is CCCS(=O)(=O)N(c1ccc2c(c1)N(S(C)(=O)=O)CCC2)S(=O)(=O)CCC.
What is the InChIKey of N-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-7-yl)-N-propylsulfonylpropane-1-sulfonamide?
The InChIKey is DPNPDANNXCXTCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N2O6S3/c1-4-11-26(21,22)18(27(23,24)12-5-2)15-9-8-14-7-6-10-17(16(14)13-15)25(3,19)20/h8-9,13H,4-7,10-12H2,1-3H3.
What are the key properties of N-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-7-yl)-N-propylsulfonylpropane-1-sulfonamide?
N-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-7-yl)-N-propylsulfonylpropane-1-sulfonamide has a molecular weight of 438.59 g/mol, XLogP of 1.68, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-7-yl)-N-propylsulfonylpropane-1-sulfonamide is sourced from PubChem (CID 162664328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).