C19H17BrN4O5S — CID 162664506
N-[[5-(benzamidocarbamoyl)-4-methyl-1,3-oxazol-2-yl]methyl]-3-bromobenzenesulfonamide (PubChem CID 162664506) has the molecular formula C19H17BrN4O5S and a molecular weight of 493.34 g/mol. Its IUPAC name is N-[[5-(benzamidocarbamoyl)-4-methyl-1,3-oxazol-2-yl]methyl]-3-bromobenzenesulfonamide.
| Compound Name | N-[[5-(benzamidocarbamoyl)-4-methyl-1,3-oxazol-2-yl]methyl]-3-bromobenzenesulfonamide |
|---|---|
| PubChem CID | 162664506 |
| Molecular Formula | C19H17BrN4O5S |
| Molecular Weight | 493.34 g/mol |
| Exact Mass | 492.01 |
| IUPAC Name | N-[[5-(benzamidocarbamoyl)-4-methyl-1,3-oxazol-2-yl]methyl]-3-bromobenzenesulfonamide |
| SMILES | Cc1nc(CNS(=O)(=O)c2cccc(Br)c2)oc1C(=O)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H17BrN4O5S/c1-12-17(19(26)24-23-18(25)13-6-3-2-4-7-13)29-16(22-12)11-21-30(27,28)15-9-5-8-14(20)10-15/h2-10,21H,11H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | PJLVVLLIXYOTQN-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 130.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|