C24H29N5O3S — CID 162664608
N-[1-[4-(methylcarbamoyl)-2-phenyl-1H-imidazol-5-yl]-7-oxononyl]-1,3-thiazole-5-carboxamide (PubChem CID 162664608) has the molecular formula C24H29N5O3S and a molecular weight of 467.60 g/mol. Its IUPAC name is N-[1-[4-(methylcarbamoyl)-2-phenyl-1H-imidazol-5-yl]-7-oxononyl]-1,3-thiazole-5-carboxamide.
| Compound Name | N-[1-[4-(methylcarbamoyl)-2-phenyl-1H-imidazol-5-yl]-7-oxononyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 162664608 |
| Molecular Formula | C24H29N5O3S |
| Molecular Weight | 467.60 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | N-[1-[4-(methylcarbamoyl)-2-phenyl-1H-imidazol-5-yl]-7-oxononyl]-1,3-thiazole-5-carboxamide |
| SMILES | CCC(=O)CCCCCC(NC(=O)c1cncs1)c1[nH]c(-c2ccccc2)nc1C(=O)NC |
| InChI | InChI=1S/C24H29N5O3S/c1-3-17(30)12-8-5-9-13-18(27-23(31)19-14-26-15-33-19)20-21(24(32)25-2)29-22(28-20)16-10-6-4-7-11-16/h4,6-7,10-11,14-15,18H,3,5,8-9,12-13H2,1-2H3,(H,25,32)(H,27,31)(H,28,29) |
| InChIKey | PLHIZHDQYPUMEN-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.60 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|