C19H18O6 — CID 162664652
(1R,2R,5S,7R,8R,11S,12R,13S)-5-hydroxy-13-methyl-19-methylidene-9,17-dioxahexacyclo[11.3.2.15,8.01,12.02,7.07,11]nonadec-15-ene-10,14,18-trione (PubChem CID 162664652) has the molecular formula C19H18O6 and a molecular weight of 342.35 g/mol. Its IUPAC name is (1R,2R,5S,7R,8R,11S,12R,13S)-5-hydroxy-13-methyl-19-methylidene-9,17-dioxahexacyclo[11.3.2.15,8.01,12.02,7.07,11]nonadec-15-ene-10,14,18-trione.
| Compound Name | (1R,2R,5S,7R,8R,11S,12R,13S)-5-hydroxy-13-methyl-19-methylidene-9,17-dioxahexacyclo[11.3.2.15,8.01,12.02,7.07,11]nonadec-15-ene-10,14,18-trione |
|---|---|
| PubChem CID | 162664652 |
| Molecular Formula | C19H18O6 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | (1R,2R,5S,7R,8R,11S,12R,13S)-5-hydroxy-13-methyl-19-methylidene-9,17-dioxahexacyclo[11.3.2.15,8.01,12.02,7.07,11]nonadec-15-ene-10,14,18-trione |
| SMILES | C=C1[C@@H]2OC(=O)[C@H]3[C@@H]4[C@@]5(C)C(=O)C=C[C@@]4(OC5=O)[C@@H]4CC[C@]1(O)C[C@]234 |
| InChI | InChI=1S/C19H18O6/c1-8-13-18-7-17(8,23)5-3-9(18)19-6-4-10(20)16(2,15(22)25-19)12(19)11(18)14(21)24-13/h4,6,9,11-13,23H,1,3,5,7H2,2H3/t9-,11-,12-,13+,16-,17+,18-,19-/m1/s1 |
| InChIKey | VQCZGDDSUJGRNQ-KBWOSQCISA-N |
| XLogP | 0.69 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|