C23H25N3O2S — CID 162664711
2-(4-methylpiperidin-1-yl)-N-[4-[(2-oxo-1H-quinolin-4-yl)sulfanyl]phenyl]acetamide (PubChem CID 162664711) has the molecular formula C23H25N3O2S and a molecular weight of 407.54 g/mol. Its IUPAC name is 2-(4-methylpiperidin-1-yl)-N-[4-[(2-oxo-1H-quinolin-4-yl)sulfanyl]phenyl]acetamide.
| Compound Name | 2-(4-methylpiperidin-1-yl)-N-[4-[(2-oxo-1H-quinolin-4-yl)sulfanyl]phenyl]acetamide |
|---|---|
| PubChem CID | 162664711 |
| Molecular Formula | C23H25N3O2S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 2-(4-methylpiperidin-1-yl)-N-[4-[(2-oxo-1H-quinolin-4-yl)sulfanyl]phenyl]acetamide |
| SMILES | CC1CCN(CC(=O)Nc2ccc(Sc3cc(=O)[nH]c4ccccc34)cc2)CC1 |
| InChI | InChI=1S/C23H25N3O2S/c1-16-10-12-26(13-11-16)15-23(28)24-17-6-8-18(9-7-17)29-21-14-22(27)25-20-5-3-2-4-19(20)21/h2-9,14,16H,10-13,15H2,1H3,(H,24,28)(H,25,27) |
| InChIKey | HXJYWVOSFUHUIM-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |