C14H13F3N6O — CID 162664793
2-N-(4-methoxyphenyl)-6-N-(2,2,2-trifluoroethyl)-7H-purine-2,6-diamine (PubChem CID 162664793) has the molecular formula C14H13F3N6O and a molecular weight of 338.29 g/mol. Its IUPAC name is 2-N-(4-methoxyphenyl)-6-N-(2,2,2-trifluoroethyl)-7H-purine-2,6-diamine.
| Compound Name | 2-N-(4-methoxyphenyl)-6-N-(2,2,2-trifluoroethyl)-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 162664793 |
| Molecular Formula | C14H13F3N6O |
| Molecular Weight | 338.29 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 2-N-(4-methoxyphenyl)-6-N-(2,2,2-trifluoroethyl)-7H-purine-2,6-diamine |
| SMILES | COc1ccc(Nc2nc(NCC(F)(F)F)c3[nH]cnc3n2)cc1 |
| InChI | InChI=1S/C14H13F3N6O/c1-24-9-4-2-8(3-5-9)21-13-22-11(18-6-14(15,16)17)10-12(23-13)20-7-19-10/h2-5,7H,6H2,1H3,(H3,18,19,20,21,22,23) |
| InChIKey | KARXZESVXXMTEV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 87.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.29 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |