C17H23NO4S — CID 162664881
butyl 2-(7-methyl-1,1-dioxo-2-prop-2-enyl-3H-1,2-benzothiazol-3-yl)acetate (PubChem CID 162664881) has the molecular formula C17H23NO4S and a molecular weight of 337.44 g/mol. Its IUPAC name is butyl 2-(7-methyl-1,1-dioxo-2-prop-2-enyl-3H-1,2-benzothiazol-3-yl)acetate.
| Compound Name | butyl 2-(7-methyl-1,1-dioxo-2-prop-2-enyl-3H-1,2-benzothiazol-3-yl)acetate |
|---|---|
| PubChem CID | 162664881 |
| Molecular Formula | C17H23NO4S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | butyl 2-(7-methyl-1,1-dioxo-2-prop-2-enyl-3H-1,2-benzothiazol-3-yl)acetate |
| SMILES | C=CCN1C(CC(=O)OCCCC)c2cccc(C)c2S1(=O)=O |
| InChI | InChI=1S/C17H23NO4S/c1-4-6-11-22-16(19)12-15-14-9-7-8-13(3)17(14)23(20,21)18(15)10-5-2/h5,7-9,15H,2,4,6,10-12H2,1,3H3 |
| InChIKey | QQRXBGDONCQSNB-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|