C30H35F3O7 — CID 162664972
[(1R,2R,4R,9S,10S,11S,13R,16R)-9-(acetyloxymethyl)-2,11-dihydroxy-5,5-dimethyl-14-methylidene-15-oxo-16-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] 2-(trifluoromethyl)benzoate (PubChem CID 162664972) has the molecular formula C30H35F3O7 and a molecular weight of 564.60 g/mol. Its IUPAC name is [(1R,2R,4R,9S,10S,11S,13R,16R)-9-(acetyloxymethyl)-2,11-dihydroxy-5,5-dimethyl-14-methylidene-15-oxo-16-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] 2-(trifluoromethyl)benzoate.
| Compound Name | [(1R,2R,4R,9S,10S,11S,13R,16R)-9-(acetyloxymethyl)-2,11-dihydroxy-5,5-dimethyl-14-methylidene-15-oxo-16-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] 2-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 162664972 |
| Molecular Formula | C30H35F3O7 |
| Molecular Weight | 564.60 g/mol |
| Exact Mass | 564.23 |
| IUPAC Name | [(1R,2R,4R,9S,10S,11S,13R,16R)-9-(acetyloxymethyl)-2,11-dihydroxy-5,5-dimethyl-14-methylidene-15-oxo-16-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] 2-(trifluoromethyl)benzoate |
| SMILES | C=C1C(=O)[C@@]23[C@H](O)C[C@@H]4C(C)(C)CCC[C@@]4(COC(C)=O)[C@@H]2[C@@H](O)C[C@H]1[C@H]3OC(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C30H35F3O7/c1-15-18-12-20(35)23-28(14-39-16(2)34)11-7-10-27(3,4)21(28)13-22(36)29(23,24(15)37)25(18)40-26(38)17-8-5-6-9-19(17)30(31,32)33/h5-6,8-9,18,20-23,25,35-36H,1,7,10-14H2,2-4H3/t18-,20+,21-,22-,23+,25-,28+,29-/m1/s1 |
| InChIKey | PRHTXSPUDMBUKE-UYRIERQWSA-N |
| XLogP | 4.49 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.60 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|