About methyl 4-amino-5,5-dimethyl-6H-benzo[h]quinazoline-8-carboxylate
methyl 4-amino-5,5-dimethyl-6H-benzo[h]quinazoline-8-carboxylate (PubChem CID 162664978) has the molecular formula C16H17N3O2
and a molecular weight of 283.33 g/mol. Its IUPAC name is methyl 4-amino-5,5-dimethyl-6H-benzo[h]quinazoline-8-carboxylate.
Molecular Properties
| Compound Name | methyl 4-amino-5,5-dimethyl-6H-benzo[h]quinazoline-8-carboxylate |
| PubChem CID | 162664978 |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | methyl 4-amino-5,5-dimethyl-6H-benzo[h]quinazoline-8-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)CC(C)(C)c1c(N)ncnc1-2 |
| InChI | InChI=1S/C16H17N3O2/c1-16(2)7-10-6-9(15(20)21-3)4-5-11(10)13-12(16)14(17)19-8-18-13/h4-6,8H,7H2,1-3H3,(H2,17,18,19) |
| InChIKey | IBZKOVZOMXVHPL-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 4-amino-5,5-dimethyl-6H-benzo[h]quinazoline-8-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-amino-5,5-dimethyl-6H-benzo[h]quinazoline-8-carboxylate?
The IUPAC name of methyl 4-amino-5,5-dimethyl-6H-benzo[h]quinazoline-8-carboxylate (CID 162664978) is methyl 4-amino-5,5-dimethyl-6H-benzo[h]quinazoline-8-carboxylate.
What is the SMILES notation for methyl 4-amino-5,5-dimethyl-6H-benzo[h]quinazoline-8-carboxylate?
The canonical SMILES for methyl 4-amino-5,5-dimethyl-6H-benzo[h]quinazoline-8-carboxylate is COC(=O)c1ccc2c(c1)CC(C)(C)c1c(N)ncnc1-2.
What is the InChIKey of methyl 4-amino-5,5-dimethyl-6H-benzo[h]quinazoline-8-carboxylate?
The InChIKey is IBZKOVZOMXVHPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3O2/c1-16(2)7-10-6-9(15(20)21-3)4-5-11(10)13-12(16)14(17)19-8-18-13/h4-6,8H,7H2,1-3H3,(H2,17,18,19).
What are the key properties of methyl 4-amino-5,5-dimethyl-6H-benzo[h]quinazoline-8-carboxylate?
methyl 4-amino-5,5-dimethyl-6H-benzo[h]quinazoline-8-carboxylate has a molecular weight of 283.33 g/mol, XLogP of 2.35, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-amino-5,5-dimethyl-6H-benzo[h]quinazoline-8-carboxylate is sourced from PubChem (CID 162664978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).