C29H36ClN3O5S2 — CID 162665012
13-ethoxy-6-methylidene-4,8-bis-(4-methylphenyl)sulfonyl-4,8,15-triazabicyclo[9.3.1]pentadeca-1(14),11(15),12-triene;hydrochloride (PubChem CID 162665012) has the molecular formula C29H36ClN3O5S2 and a molecular weight of 606.21 g/mol. Its IUPAC name is 13-ethoxy-6-methylidene-4,8-bis-(4-methylphenyl)sulfonyl-4,8,15-triazabicyclo[9.3.1]pentadeca-1(14),11(15),12-triene;hydrochloride.
| Compound Name | 13-ethoxy-6-methylidene-4,8-bis-(4-methylphenyl)sulfonyl-4,8,15-triazabicyclo[9.3.1]pentadeca-1(14),11(15),12-triene;hydrochloride |
|---|---|
| PubChem CID | 162665012 |
| Molecular Formula | C29H36ClN3O5S2 |
| Molecular Weight | 606.21 g/mol |
| Exact Mass | 605.18 |
| IUPAC Name | 13-ethoxy-6-methylidene-4,8-bis-(4-methylphenyl)sulfonyl-4,8,15-triazabicyclo[9.3.1]pentadeca-1(14),11(15),12-triene;hydrochloride |
| SMILES | C=C1CN(S(=O)(=O)c2ccc(C)cc2)CCc2cc(OCC)cc(n2)CCN(S(=O)(=O)c2ccc(C)cc2)C1.Cl |
| InChI | InChI=1S/C29H35N3O5S2.ClH/c1-5-37-27-18-25-14-16-31(38(33,34)28-10-6-22(2)7-11-28)20-24(4)21-32(17-15-26(19-27)30-25)39(35,36)29-12-8-23(3)9-13-29;/h6-13,18-19H,4-5,14-17,20-21H2,1-3H3;1H |
| InChIKey | WFBTZGCKJZZDQM-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 96.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.21 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|