C17H15N3O3 — CID 162665089
3-(4-methoxyanilino)-4-(pyridin-2-ylmethylamino)cyclobut-3-ene-1,2-dione (PubChem CID 162665089) has the molecular formula C17H15N3O3 and a molecular weight of 309.33 g/mol. Its IUPAC name is 3-(4-methoxyanilino)-4-(pyridin-2-ylmethylamino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(4-methoxyanilino)-4-(pyridin-2-ylmethylamino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 162665089 |
| Molecular Formula | C17H15N3O3 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 3-(4-methoxyanilino)-4-(pyridin-2-ylmethylamino)cyclobut-3-ene-1,2-dione |
| SMILES | COc1ccc(Nc2c(NCc3ccccn3)c(=O)c2=O)cc1 |
| InChI | InChI=1S/C17H15N3O3/c1-23-13-7-5-11(6-8-13)20-15-14(16(21)17(15)22)19-10-12-4-2-3-9-18-12/h2-9,19-20H,10H2,1H3 |
| InChIKey | UZYLGYYILPNSKI-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|