C30H28Cl2FN3O3 — CID 162665106
4-[[[(2'S,3S,3'S,4'S)-6-chloro-4'-(3-chloro-2-fluorophenyl)-1'-(cyclopropylmethyl)-2'-methyl-2-oxospiro[1H-indole-3,5'-pyrrolidine]-3'-yl]amino]methyl]benzoic acid (PubChem CID 162665106) has the molecular formula C30H28Cl2FN3O3 and a molecular weight of 568.48 g/mol. Its IUPAC name is 4-[[[(2'S,3S,3'S,4'S)-6-chloro-4'-(3-chloro-2-fluorophenyl)-1'-(cyclopropylmethyl)-2'-methyl-2-oxospiro[1H-indole-3,5'-pyrrolidine]-3'-yl]amino]methyl]benzoic acid.
| Compound Name | 4-[[[(2'S,3S,3'S,4'S)-6-chloro-4'-(3-chloro-2-fluorophenyl)-1'-(cyclopropylmethyl)-2'-methyl-2-oxospiro[1H-indole-3,5'-pyrrolidine]-3'-yl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 162665106 |
| Molecular Formula | C30H28Cl2FN3O3 |
| Molecular Weight | 568.48 g/mol |
| Exact Mass | 567.15 |
| IUPAC Name | 4-[[[(2'S,3S,3'S,4'S)-6-chloro-4'-(3-chloro-2-fluorophenyl)-1'-(cyclopropylmethyl)-2'-methyl-2-oxospiro[1H-indole-3,5'-pyrrolidine]-3'-yl]amino]methyl]benzoic acid |
| SMILES | C[C@H]1[C@@H](NCc2ccc(C(=O)O)cc2)[C@H](c2cccc(Cl)c2F)[C@]2(C(=O)Nc3cc(Cl)ccc32)N1CC1CC1 |
| InChI | InChI=1S/C30H28Cl2FN3O3/c1-16-27(34-14-17-7-9-19(10-8-17)28(37)38)25(21-3-2-4-23(32)26(21)33)30(36(16)15-18-5-6-18)22-12-11-20(31)13-24(22)35-29(30)39/h2-4,7-13,16,18,25,27,34H,5-6,14-15H2,1H3,(H,35,39)(H,37,38)/t16-,25-,27+,30+/m0/s1 |
| InChIKey | LOSZKERARNYENB-VBIQYGPKSA-N |
| XLogP | 6.03 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.48 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |