C20H16N6O3 — CID 162665221
4-[4-[4-[(E)-hydroxyiminomethyl]-1-phenylpyrazol-3-yl]-5-methyltriazol-1-yl]benzoic acid (PubChem CID 162665221) has the molecular formula C20H16N6O3 and a molecular weight of 388.39 g/mol. Its IUPAC name is 4-[4-[4-[(E)-hydroxyiminomethyl]-1-phenylpyrazol-3-yl]-5-methyltriazol-1-yl]benzoic acid.
| Compound Name | 4-[4-[4-[(E)-hydroxyiminomethyl]-1-phenylpyrazol-3-yl]-5-methyltriazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 162665221 |
| Molecular Formula | C20H16N6O3 |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 4-[4-[4-[(E)-hydroxyiminomethyl]-1-phenylpyrazol-3-yl]-5-methyltriazol-1-yl]benzoic acid |
| SMILES | Cc1c(-c2nn(-c3ccccc3)cc2/C=N/O)nnn1-c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C20H16N6O3/c1-13-18(22-24-26(13)17-9-7-14(8-10-17)20(27)28)19-15(11-21-29)12-25(23-19)16-5-3-2-4-6-16/h2-12,29H,1H3,(H,27,28)/b21-11+ |
| InChIKey | GTVGUYLLAFHOLS-SRZZPIQSSA-N |
| XLogP | 2.93 |
| TPSA | 118.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|