C30H29F7N2O4S — CID 162665288
(3S,4S)-N-[(4-ethylsulfonylphenyl)methyl]-3-(4-fluorophenyl)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methylpyrrolidine-1-carboxamide (PubChem CID 162665288) has the molecular formula C30H29F7N2O4S and a molecular weight of 646.62 g/mol. Its IUPAC name is (3S,4S)-N-[(4-ethylsulfonylphenyl)methyl]-3-(4-fluorophenyl)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methylpyrrolidine-1-carboxamide.
| Compound Name | (3S,4S)-N-[(4-ethylsulfonylphenyl)methyl]-3-(4-fluorophenyl)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 162665288 |
| Molecular Formula | C30H29F7N2O4S |
| Molecular Weight | 646.62 g/mol |
| Exact Mass | 646.17 |
| IUPAC Name | (3S,4S)-N-[(4-ethylsulfonylphenyl)methyl]-3-(4-fluorophenyl)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methylpyrrolidine-1-carboxamide |
| SMILES | CCS(=O)(=O)c1ccc(CNC(=O)N2C[C@@H](c3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)[C@@](C)(c3ccc(F)cc3)C2)cc1 |
| InChI | InChI=1S/C30H29F7N2O4S/c1-3-44(42,43)24-14-4-19(5-15-24)16-38-26(40)39-17-25(27(2,18-39)21-10-12-23(31)13-11-21)20-6-8-22(9-7-20)28(41,29(32,33)34)30(35,36)37/h4-15,25,41H,3,16-18H2,1-2H3,(H,38,40)/t25-,27+/m0/s1 |
| InChIKey | IBNDCXHHUIUCTG-AHKZPQOWSA-N |
| XLogP | 6.20 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.62 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |