About 4-(3,5-dimethyl-1,2-oxazol-4-yl)-1-pentylimidazol-2-amine;hydrochloride
4-(3,5-dimethyl-1,2-oxazol-4-yl)-1-pentylimidazol-2-amine;hydrochloride (PubChem CID 162665308) has the molecular formula C13H21ClN4O
and a molecular weight of 284.79 g/mol. Its IUPAC name is 4-(3,5-dimethyl-1,2-oxazol-4-yl)-1-pentylimidazol-2-amine;hydrochloride.
Molecular Properties
| Compound Name | 4-(3,5-dimethyl-1,2-oxazol-4-yl)-1-pentylimidazol-2-amine;hydrochloride |
| PubChem CID | 162665308 |
| Molecular Formula | C13H21ClN4O |
| Molecular Weight | 284.79 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 4-(3,5-dimethyl-1,2-oxazol-4-yl)-1-pentylimidazol-2-amine;hydrochloride |
| SMILES | CCCCCn1cc(-c2c(C)noc2C)nc1N.Cl |
| InChI | InChI=1S/C13H20N4O.ClH/c1-4-5-6-7-17-8-11(15-13(17)14)12-9(2)16-18-10(12)3;/h8H,4-7H2,1-3H3,(H2,14,15);1H |
| InChIKey | XDRILNZELRIXFI-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.79 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(3,5-dimethyl-1,2-oxazol-4-yl)-1-pentylimidazol-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,5-dimethyl-1,2-oxazol-4-yl)-1-pentylimidazol-2-amine;hydrochloride?
The IUPAC name of 4-(3,5-dimethyl-1,2-oxazol-4-yl)-1-pentylimidazol-2-amine;hydrochloride (CID 162665308) is 4-(3,5-dimethyl-1,2-oxazol-4-yl)-1-pentylimidazol-2-amine;hydrochloride.
What is the SMILES notation for 4-(3,5-dimethyl-1,2-oxazol-4-yl)-1-pentylimidazol-2-amine;hydrochloride?
The canonical SMILES for 4-(3,5-dimethyl-1,2-oxazol-4-yl)-1-pentylimidazol-2-amine;hydrochloride is CCCCCn1cc(-c2c(C)noc2C)nc1N.Cl.
What is the InChIKey of 4-(3,5-dimethyl-1,2-oxazol-4-yl)-1-pentylimidazol-2-amine;hydrochloride?
The InChIKey is XDRILNZELRIXFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N4O.ClH/c1-4-5-6-7-17-8-11(15-13(17)14)12-9(2)16-18-10(12)3;/h8H,4-7H2,1-3H3,(H2,14,15);1H.
What are the key properties of 4-(3,5-dimethyl-1,2-oxazol-4-yl)-1-pentylimidazol-2-amine;hydrochloride?
4-(3,5-dimethyl-1,2-oxazol-4-yl)-1-pentylimidazol-2-amine;hydrochloride has a molecular weight of 284.79 g/mol, XLogP of 3.35, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,5-dimethyl-1,2-oxazol-4-yl)-1-pentylimidazol-2-amine;hydrochloride is sourced from PubChem (CID 162665308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).