About N-[5-(2,4-difluorobenzoyl)-4-phenyl-1,3-thiazol-2-yl]benzamide
N-[5-(2,4-difluorobenzoyl)-4-phenyl-1,3-thiazol-2-yl]benzamide (PubChem CID 162665401) has the molecular formula C23H14F2N2O2S
and a molecular weight of 420.44 g/mol. Its IUPAC name is N-[5-(2,4-difluorobenzoyl)-4-phenyl-1,3-thiazol-2-yl]benzamide.
Molecular Properties
| Compound Name | N-[5-(2,4-difluorobenzoyl)-4-phenyl-1,3-thiazol-2-yl]benzamide |
| PubChem CID | 162665401 |
| Molecular Formula | C23H14F2N2O2S |
| Molecular Weight | 420.44 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | N-[5-(2,4-difluorobenzoyl)-4-phenyl-1,3-thiazol-2-yl]benzamide |
| SMILES | O=C(Nc1nc(-c2ccccc2)c(C(=O)c2ccc(F)cc2F)s1)c1ccccc1 |
| InChI | InChI=1S/C23H14F2N2O2S/c24-16-11-12-17(18(25)13-16)20(28)21-19(14-7-3-1-4-8-14)26-23(30-21)27-22(29)15-9-5-2-6-10-15/h1-13H,(H,26,27,29) |
| InChIKey | TZEPHGNXKFLTDO-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.44 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[5-(2,4-difluorobenzoyl)-4-phenyl-1,3-thiazol-2-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-(2,4-difluorobenzoyl)-4-phenyl-1,3-thiazol-2-yl]benzamide?
The IUPAC name of N-[5-(2,4-difluorobenzoyl)-4-phenyl-1,3-thiazol-2-yl]benzamide (CID 162665401) is N-[5-(2,4-difluorobenzoyl)-4-phenyl-1,3-thiazol-2-yl]benzamide.
What is the SMILES notation for N-[5-(2,4-difluorobenzoyl)-4-phenyl-1,3-thiazol-2-yl]benzamide?
The canonical SMILES for N-[5-(2,4-difluorobenzoyl)-4-phenyl-1,3-thiazol-2-yl]benzamide is O=C(Nc1nc(-c2ccccc2)c(C(=O)c2ccc(F)cc2F)s1)c1ccccc1.
What is the InChIKey of N-[5-(2,4-difluorobenzoyl)-4-phenyl-1,3-thiazol-2-yl]benzamide?
The InChIKey is TZEPHGNXKFLTDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H14F2N2O2S/c24-16-11-12-17(18(25)13-16)20(28)21-19(14-7-3-1-4-8-14)26-23(30-21)27-22(29)15-9-5-2-6-10-15/h1-13H,(H,26,27,29).
What are the key properties of N-[5-(2,4-difluorobenzoyl)-4-phenyl-1,3-thiazol-2-yl]benzamide?
N-[5-(2,4-difluorobenzoyl)-4-phenyl-1,3-thiazol-2-yl]benzamide has a molecular weight of 420.44 g/mol, XLogP of 5.57, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-(2,4-difluorobenzoyl)-4-phenyl-1,3-thiazol-2-yl]benzamide is sourced from PubChem (CID 162665401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).