C36H17F8N5 — CID 162665419
10-pyridin-3-yl-5,15-bis(2,3,5,6-tetrafluorophenyl)-22,23-dihydro-21H-corrin (PubChem CID 162665419) has the molecular formula C36H17F8N5 and a molecular weight of 671.55 g/mol. Its IUPAC name is 10-pyridin-3-yl-5,15-bis(2,3,5,6-tetrafluorophenyl)-22,23-dihydro-21H-corrin.
| Compound Name | 10-pyridin-3-yl-5,15-bis(2,3,5,6-tetrafluorophenyl)-22,23-dihydro-21H-corrin |
|---|---|
| PubChem CID | 162665419 |
| Molecular Formula | C36H17F8N5 |
| Molecular Weight | 671.55 g/mol |
| Exact Mass | 671.14 |
| IUPAC Name | 10-pyridin-3-yl-5,15-bis(2,3,5,6-tetrafluorophenyl)-22,23-dihydro-21H-corrin |
| SMILES | Fc1cc(F)c(F)c(-c2c3nc(c4ccc([nH]4)c(-c4c(F)c(F)cc(F)c4F)c4ccc([nH]4)c(-c4cccnc4)c4ccc2[nH]4)C=C3)c1F |
| InChI | InChI=1S/C36H17F8N5/c37-16-12-17(38)34(42)31(33(16)41)29-24-5-3-20(46-24)21-4-6-25(47-21)30(32-35(43)18(39)13-19(40)36(32)44)27-10-8-23(49-27)28(15-2-1-11-45-14-15)22-7-9-26(29)48-22/h1-14,46,48-49H/b21-20-,28-22-,28-23-,29-24+,29-26+,30-25+,30-27+ |
| InChIKey | VETFNFKRTWGWBO-GCMUTNQRSA-N |
| XLogP | 10.20 |
| TPSA | 73.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.55 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|