C21H26N2O3 — CID 162665437
(3Z,6Z)-3-hexylidene-6-[(4-methoxyphenyl)methylidene]-1-prop-2-enylpiperazine-2,5-dione (PubChem CID 162665437) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is (3Z,6Z)-3-hexylidene-6-[(4-methoxyphenyl)methylidene]-1-prop-2-enylpiperazine-2,5-dione.
| Compound Name | (3Z,6Z)-3-hexylidene-6-[(4-methoxyphenyl)methylidene]-1-prop-2-enylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 162665437 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | (3Z,6Z)-3-hexylidene-6-[(4-methoxyphenyl)methylidene]-1-prop-2-enylpiperazine-2,5-dione |
| SMILES | C=CCn1c(=O)/c(=C/CCCCC)[nH]c(=O)/c1=C/c1ccc(OC)cc1 |
| InChI | InChI=1S/C21H26N2O3/c1-4-6-7-8-9-18-21(25)23(14-5-2)19(20(24)22-18)15-16-10-12-17(26-3)13-11-16/h5,9-13,15H,2,4,6-8,14H2,1,3H3,(H,22,24)/b18-9-,19-15- |
| InChIKey | KWAFRXXCXKALCQ-WPSYNCJXSA-N |
| XLogP | 1.92 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|