C25H27N7O2 — CID 162665518
(E)-N-[3-[[4-[4-(piperidine-1-carbonyl)anilino]-1,3,5-triazin-2-yl]amino]phenyl]but-2-enamide (PubChem CID 162665518) has the molecular formula C25H27N7O2 and a molecular weight of 457.54 g/mol. Its IUPAC name is (E)-N-[3-[[4-[4-(piperidine-1-carbonyl)anilino]-1,3,5-triazin-2-yl]amino]phenyl]but-2-enamide.
| Compound Name | (E)-N-[3-[[4-[4-(piperidine-1-carbonyl)anilino]-1,3,5-triazin-2-yl]amino]phenyl]but-2-enamide |
|---|---|
| PubChem CID | 162665518 |
| Molecular Formula | C25H27N7O2 |
| Molecular Weight | 457.54 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | (E)-N-[3-[[4-[4-(piperidine-1-carbonyl)anilino]-1,3,5-triazin-2-yl]amino]phenyl]but-2-enamide |
| SMILES | C/C=C/C(=O)Nc1cccc(Nc2ncnc(Nc3ccc(C(=O)N4CCCCC4)cc3)n2)c1 |
| InChI | InChI=1S/C25H27N7O2/c1-2-7-22(33)28-20-8-6-9-21(16-20)30-25-27-17-26-24(31-25)29-19-12-10-18(11-13-19)23(34)32-14-4-3-5-15-32/h2,6-13,16-17H,3-5,14-15H2,1H3,(H,28,33)(H2,26,27,29,30,31)/b7-2+ |
| InChIKey | XBSBFRLFLJCUJN-FARCUNLSSA-N |
| XLogP | 4.50 |
| TPSA | 112.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.54 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|