About 3-phenyl-1H-pyrrolo[3,2-b]pyridine-2-carboxamide
3-phenyl-1H-pyrrolo[3,2-b]pyridine-2-carboxamide (PubChem CID 162665543) has the molecular formula C14H11N3O
and a molecular weight of 237.26 g/mol. Its IUPAC name is 3-phenyl-1H-pyrrolo[3,2-b]pyridine-2-carboxamide.
Molecular Properties
| Compound Name | 3-phenyl-1H-pyrrolo[3,2-b]pyridine-2-carboxamide |
| PubChem CID | 162665543 |
| Molecular Formula | C14H11N3O |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 3-phenyl-1H-pyrrolo[3,2-b]pyridine-2-carboxamide |
| SMILES | NC(=O)c1[nH]c2cccnc2c1-c1ccccc1 |
| InChI | InChI=1S/C14H11N3O/c15-14(18)13-11(9-5-2-1-3-6-9)12-10(17-13)7-4-8-16-12/h1-8,17H,(H2,15,18) |
| InChIKey | DHXMTAAMMHEHEU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-phenyl-1H-pyrrolo[3,2-b]pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-1H-pyrrolo[3,2-b]pyridine-2-carboxamide?
The IUPAC name of 3-phenyl-1H-pyrrolo[3,2-b]pyridine-2-carboxamide (CID 162665543) is 3-phenyl-1H-pyrrolo[3,2-b]pyridine-2-carboxamide.
What is the SMILES notation for 3-phenyl-1H-pyrrolo[3,2-b]pyridine-2-carboxamide?
The canonical SMILES for 3-phenyl-1H-pyrrolo[3,2-b]pyridine-2-carboxamide is NC(=O)c1[nH]c2cccnc2c1-c1ccccc1.
What is the InChIKey of 3-phenyl-1H-pyrrolo[3,2-b]pyridine-2-carboxamide?
The InChIKey is DHXMTAAMMHEHEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N3O/c15-14(18)13-11(9-5-2-1-3-6-9)12-10(17-13)7-4-8-16-12/h1-8,17H,(H2,15,18).
What are the key properties of 3-phenyl-1H-pyrrolo[3,2-b]pyridine-2-carboxamide?
3-phenyl-1H-pyrrolo[3,2-b]pyridine-2-carboxamide has a molecular weight of 237.26 g/mol, XLogP of 2.33, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-1H-pyrrolo[3,2-b]pyridine-2-carboxamide is sourced from PubChem (CID 162665543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).