C18H18N4O2 — CID 162665632
3-[4-(dimethylamino)anilino]-4-(pyridin-2-ylmethylamino)cyclobut-3-ene-1,2-dione (PubChem CID 162665632) has the molecular formula C18H18N4O2 and a molecular weight of 322.37 g/mol. Its IUPAC name is 3-[4-(dimethylamino)anilino]-4-(pyridin-2-ylmethylamino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[4-(dimethylamino)anilino]-4-(pyridin-2-ylmethylamino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 162665632 |
| Molecular Formula | C18H18N4O2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 3-[4-(dimethylamino)anilino]-4-(pyridin-2-ylmethylamino)cyclobut-3-ene-1,2-dione |
| SMILES | CN(C)c1ccc(Nc2c(NCc3ccccn3)c(=O)c2=O)cc1 |
| InChI | InChI=1S/C18H18N4O2/c1-22(2)14-8-6-12(7-9-14)21-16-15(17(23)18(16)24)20-11-13-5-3-4-10-19-13/h3-10,20-21H,11H2,1-2H3 |
| InChIKey | HZHZEWMRDZZAEW-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|