C31H35ClN4O8 — CID 162665733
1-O-[[1-(7-chloroquinolin-4-yl)triazol-4-yl]methyl] 4-O-[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] butanedioate (PubChem CID 162665733) has the molecular formula C31H35ClN4O8 and a molecular weight of 627.09 g/mol. Its IUPAC name is 1-O-[[1-(7-chloroquinolin-4-yl)triazol-4-yl]methyl] 4-O-[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] butanedioate.
| Compound Name | 1-O-[[1-(7-chloroquinolin-4-yl)triazol-4-yl]methyl] 4-O-[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] butanedioate |
|---|---|
| PubChem CID | 162665733 |
| Molecular Formula | C31H35ClN4O8 |
| Molecular Weight | 627.09 g/mol |
| Exact Mass | 626.21 |
| IUPAC Name | 1-O-[[1-(7-chloroquinolin-4-yl)triazol-4-yl]methyl] 4-O-[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] butanedioate |
| SMILES | C[C@H]1[C@H](OC(=O)CCC(=O)OCc2cn(-c3ccnc4cc(Cl)ccc34)nn2)O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CC[C@@H]1[C@@]24OO3 |
| InChI | InChI=1S/C31H35ClN4O8/c1-17-4-7-23-18(2)28(41-29-31(23)22(17)10-12-30(3,42-29)43-44-31)40-27(38)9-8-26(37)39-16-20-15-36(35-34-20)25-11-13-33-24-14-19(32)5-6-21(24)25/h5-6,11,13-15,17-18,22-23,28-29H,4,7-10,12,16H2,1-3H3/t17-,18-,22+,23+,28-,29-,30-,31-/m1/s1 |
| InChIKey | QVBCIDHRXXZGPE-TVDRNVDCSA-N |
| XLogP | 5.04 |
| TPSA | 133.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.09 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|