C11H6F3N3S — CID 162665845
4-[1-(trifluoromethyl)benzimidazol-2-yl]-1,3-thiazole (PubChem CID 162665845) has the molecular formula C11H6F3N3S and a molecular weight of 269.25 g/mol. Its IUPAC name is 4-[1-(trifluoromethyl)benzimidazol-2-yl]-1,3-thiazole.
| Compound Name | 4-[1-(trifluoromethyl)benzimidazol-2-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 162665845 |
| Molecular Formula | C11H6F3N3S |
| Molecular Weight | 269.25 g/mol |
| Exact Mass | 269.02 |
| IUPAC Name | 4-[1-(trifluoromethyl)benzimidazol-2-yl]-1,3-thiazole |
| SMILES | FC(F)(F)n1c(-c2cscn2)nc2ccccc21 |
| InChI | InChI=1S/C11H6F3N3S/c12-11(13,14)17-9-4-2-1-3-7(9)16-10(17)8-5-18-6-15-8/h1-6H |
| InChIKey | DHNLWZCXYBJXER-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.25 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |