About 2-(furan-2-yl)-N-(3-methoxypropyl)-3-pentylimidazo[4,5-b]pyridin-7-amine
2-(furan-2-yl)-N-(3-methoxypropyl)-3-pentylimidazo[4,5-b]pyridin-7-amine (PubChem CID 162665884) has the molecular formula C19H26N4O2
and a molecular weight of 342.44 g/mol. Its IUPAC name is 2-(furan-2-yl)-N-(3-methoxypropyl)-3-pentylimidazo[4,5-b]pyridin-7-amine.
Molecular Properties
| Compound Name | 2-(furan-2-yl)-N-(3-methoxypropyl)-3-pentylimidazo[4,5-b]pyridin-7-amine |
| PubChem CID | 162665884 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | 2-(furan-2-yl)-N-(3-methoxypropyl)-3-pentylimidazo[4,5-b]pyridin-7-amine |
| SMILES | CCCCCn1c(-c2ccco2)nc2c(NCCCOC)ccnc21 |
| InChI | InChI=1S/C19H26N4O2/c1-3-4-5-12-23-18(16-8-6-14-25-16)22-17-15(9-11-21-19(17)23)20-10-7-13-24-2/h6,8-9,11,14H,3-5,7,10,12-13H2,1-2H3,(H,20,21) |
| InChIKey | MAPVIKPJVDLTQE-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 65.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(furan-2-yl)-N-(3-methoxypropyl)-3-pentylimidazo[4,5-b]pyridin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(furan-2-yl)-N-(3-methoxypropyl)-3-pentylimidazo[4,5-b]pyridin-7-amine?
The IUPAC name of 2-(furan-2-yl)-N-(3-methoxypropyl)-3-pentylimidazo[4,5-b]pyridin-7-amine (CID 162665884) is 2-(furan-2-yl)-N-(3-methoxypropyl)-3-pentylimidazo[4,5-b]pyridin-7-amine.
What is the SMILES notation for 2-(furan-2-yl)-N-(3-methoxypropyl)-3-pentylimidazo[4,5-b]pyridin-7-amine?
The canonical SMILES for 2-(furan-2-yl)-N-(3-methoxypropyl)-3-pentylimidazo[4,5-b]pyridin-7-amine is CCCCCn1c(-c2ccco2)nc2c(NCCCOC)ccnc21.
What is the InChIKey of 2-(furan-2-yl)-N-(3-methoxypropyl)-3-pentylimidazo[4,5-b]pyridin-7-amine?
The InChIKey is MAPVIKPJVDLTQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26N4O2/c1-3-4-5-12-23-18(16-8-6-14-25-16)22-17-15(9-11-21-19(17)23)20-10-7-13-24-2/h6,8-9,11,14H,3-5,7,10,12-13H2,1-2H3,(H,20,21).
What are the key properties of 2-(furan-2-yl)-N-(3-methoxypropyl)-3-pentylimidazo[4,5-b]pyridin-7-amine?
2-(furan-2-yl)-N-(3-methoxypropyl)-3-pentylimidazo[4,5-b]pyridin-7-amine has a molecular weight of 342.44 g/mol, XLogP of 4.33, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(furan-2-yl)-N-(3-methoxypropyl)-3-pentylimidazo[4,5-b]pyridin-7-amine is sourced from PubChem (CID 162665884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).