C20H20ClN5O2S — CID 162665918
(2S,3R,4S)-2-[[6-[(3-chlorophenyl)methylamino]-2-prop-1-ynylpurin-9-yl]methyl]thiolane-3,4-diol (PubChem CID 162665918) has the molecular formula C20H20ClN5O2S and a molecular weight of 429.93 g/mol. Its IUPAC name is (2S,3R,4S)-2-[[6-[(3-chlorophenyl)methylamino]-2-prop-1-ynylpurin-9-yl]methyl]thiolane-3,4-diol.
| Compound Name | (2S,3R,4S)-2-[[6-[(3-chlorophenyl)methylamino]-2-prop-1-ynylpurin-9-yl]methyl]thiolane-3,4-diol |
|---|---|
| PubChem CID | 162665918 |
| Molecular Formula | C20H20ClN5O2S |
| Molecular Weight | 429.93 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | (2S,3R,4S)-2-[[6-[(3-chlorophenyl)methylamino]-2-prop-1-ynylpurin-9-yl]methyl]thiolane-3,4-diol |
| SMILES | CC#Cc1nc(NCc2cccc(Cl)c2)c2ncn(C[C@@H]3SC[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C20H20ClN5O2S/c1-2-4-16-24-19(22-8-12-5-3-6-13(21)7-12)17-20(25-16)26(11-23-17)9-15-18(28)14(27)10-29-15/h3,5-7,11,14-15,18,27-28H,8-10H2,1H3,(H,22,24,25)/t14-,15+,18-/m1/s1 |
| InChIKey | JOJDWYPPSXAAQP-RVKKMQEKSA-N |
| XLogP | 2.30 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.93 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|