C23H25NO6 — CID 162666076
N-[(7S)-1-ethenoxy-2,3,10-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide (PubChem CID 162666076) has the molecular formula C23H25NO6 and a molecular weight of 411.45 g/mol. Its IUPAC name is N-[(7S)-1-ethenoxy-2,3,10-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide.
| Compound Name | N-[(7S)-1-ethenoxy-2,3,10-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide |
|---|---|
| PubChem CID | 162666076 |
| Molecular Formula | C23H25NO6 |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | N-[(7S)-1-ethenoxy-2,3,10-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide |
| SMILES | C=COc1c(OC)c(OC)cc2c1-c1ccc(OC)c(=O)cc1[C@@H](NC(C)=O)CC2 |
| InChI | InChI=1S/C23H25NO6/c1-6-30-23-21-14(11-20(28-4)22(23)29-5)7-9-17(24-13(2)25)16-12-18(26)19(27-3)10-8-15(16)21/h6,8,10-12,17H,1,7,9H2,2-5H3,(H,24,25)/t17-/m0/s1 |
| InChIKey | SOYYFUBBLWFTDL-KRWDZBQOSA-N |
| XLogP | 3.39 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|