About (2E)-2-[(4-tert-butyl-1,3-thiazol-2-yl)imino]-1,3-thiazolidin-4-one
(2E)-2-[(4-tert-butyl-1,3-thiazol-2-yl)imino]-1,3-thiazolidin-4-one (PubChem CID 162666134) has the molecular formula C10H13N3OS2
and a molecular weight of 255.37 g/mol. Its IUPAC name is (2E)-2-[(4-tert-butyl-1,3-thiazol-2-yl)imino]-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | (2E)-2-[(4-tert-butyl-1,3-thiazol-2-yl)imino]-1,3-thiazolidin-4-one |
| PubChem CID | 162666134 |
| Molecular Formula | C10H13N3OS2 |
| Molecular Weight | 255.37 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | (2E)-2-[(4-tert-butyl-1,3-thiazol-2-yl)imino]-1,3-thiazolidin-4-one |
| SMILES | CC(C)(C)c1csc(/N=C2\NC(=O)CS2)n1 |
| InChI | InChI=1S/C10H13N3OS2/c1-10(2,3)6-4-15-8(11-6)13-9-12-7(14)5-16-9/h4H,5H2,1-3H3,(H,11,12,13,14) |
| InChIKey | XQXAXOFZDCQFGC-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.37 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-[(4-tert-butyl-1,3-thiazol-2-yl)imino]-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-[(4-tert-butyl-1,3-thiazol-2-yl)imino]-1,3-thiazolidin-4-one?
The IUPAC name of (2E)-2-[(4-tert-butyl-1,3-thiazol-2-yl)imino]-1,3-thiazolidin-4-one (CID 162666134) is (2E)-2-[(4-tert-butyl-1,3-thiazol-2-yl)imino]-1,3-thiazolidin-4-one.
What is the SMILES notation for (2E)-2-[(4-tert-butyl-1,3-thiazol-2-yl)imino]-1,3-thiazolidin-4-one?
The canonical SMILES for (2E)-2-[(4-tert-butyl-1,3-thiazol-2-yl)imino]-1,3-thiazolidin-4-one is CC(C)(C)c1csc(/N=C2\NC(=O)CS2)n1.
What is the InChIKey of (2E)-2-[(4-tert-butyl-1,3-thiazol-2-yl)imino]-1,3-thiazolidin-4-one?
The InChIKey is XQXAXOFZDCQFGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3OS2/c1-10(2,3)6-4-15-8(11-6)13-9-12-7(14)5-16-9/h4H,5H2,1-3H3,(H,11,12,13,14).
What are the key properties of (2E)-2-[(4-tert-butyl-1,3-thiazol-2-yl)imino]-1,3-thiazolidin-4-one?
(2E)-2-[(4-tert-butyl-1,3-thiazol-2-yl)imino]-1,3-thiazolidin-4-one has a molecular weight of 255.37 g/mol, XLogP of 2.29, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-[(4-tert-butyl-1,3-thiazol-2-yl)imino]-1,3-thiazolidin-4-one is sourced from PubChem (CID 162666134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).