C24H28N4O — CID 162666311
1-[(2R)-2-methyl-4-(4-methyl-3-pyridinyl)piperazin-1-yl]-4-quinolin-5-ylbutan-1-one (PubChem CID 162666311) has the molecular formula C24H28N4O and a molecular weight of 388.52 g/mol. Its IUPAC name is 1-[(2R)-2-methyl-4-(4-methyl-3-pyridinyl)piperazin-1-yl]-4-quinolin-5-ylbutan-1-one.
| Compound Name | 1-[(2R)-2-methyl-4-(4-methyl-3-pyridinyl)piperazin-1-yl]-4-quinolin-5-ylbutan-1-one |
|---|---|
| PubChem CID | 162666311 |
| Molecular Formula | C24H28N4O |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | 1-[(2R)-2-methyl-4-(4-methyl-3-pyridinyl)piperazin-1-yl]-4-quinolin-5-ylbutan-1-one |
| SMILES | Cc1ccncc1N1CCN(C(=O)CCCc2cccc3ncccc23)[C@H](C)C1 |
| InChI | InChI=1S/C24H28N4O/c1-18-11-13-25-16-23(18)27-14-15-28(19(2)17-27)24(29)10-4-7-20-6-3-9-22-21(20)8-5-12-26-22/h3,5-6,8-9,11-13,16,19H,4,7,10,14-15,17H2,1-2H3/t19-/m1/s1 |
| InChIKey | ZHDVSKYRVJBJPB-LJQANCHMSA-N |
| XLogP | 4.00 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |