C31H34N6O6 — CID 162666312
2-[[4-[2-[4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-dimethoxyphenoxy]ethylamino]benzoyl]amino]-3-phenylpropanoic acid (PubChem CID 162666312) has the molecular formula C31H34N6O6 and a molecular weight of 586.65 g/mol. Its IUPAC name is 2-[[4-[2-[4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-dimethoxyphenoxy]ethylamino]benzoyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[4-[2-[4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-dimethoxyphenoxy]ethylamino]benzoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 162666312 |
| Molecular Formula | C31H34N6O6 |
| Molecular Weight | 586.65 g/mol |
| Exact Mass | 586.25 |
| IUPAC Name | 2-[[4-[2-[4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-dimethoxyphenoxy]ethylamino]benzoyl]amino]-3-phenylpropanoic acid |
| SMILES | COc1cc(Cc2cnc(N)nc2N)cc(OC)c1OCCNc1ccc(C(=O)NC(Cc2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C31H34N6O6/c1-41-25-16-20(14-22-18-35-31(33)37-28(22)32)17-26(42-2)27(25)43-13-12-34-23-10-8-21(9-11-23)29(38)36-24(30(39)40)15-19-6-4-3-5-7-19/h3-11,16-18,24,34H,12-15H2,1-2H3,(H,36,38)(H,39,40)(H4,32,33,35,37) |
| InChIKey | UAAMNIQSVOHUSZ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 183.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.65 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|