C26H36Cl2O4 — CID 162666319
[(1Z,4R,7R,9R,10S,12E)-10-acetyloxy-2-benzyl-1,13-dichloro-7,9-dimethyltrideca-1,12-dien-4-yl] acetate (PubChem CID 162666319) has the molecular formula C26H36Cl2O4 and a molecular weight of 483.48 g/mol. Its IUPAC name is [(1Z,4R,7R,9R,10S,12E)-10-acetyloxy-2-benzyl-1,13-dichloro-7,9-dimethyltrideca-1,12-dien-4-yl] acetate.
| Compound Name | [(1Z,4R,7R,9R,10S,12E)-10-acetyloxy-2-benzyl-1,13-dichloro-7,9-dimethyltrideca-1,12-dien-4-yl] acetate |
|---|---|
| PubChem CID | 162666319 |
| Molecular Formula | C26H36Cl2O4 |
| Molecular Weight | 483.48 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | [(1Z,4R,7R,9R,10S,12E)-10-acetyloxy-2-benzyl-1,13-dichloro-7,9-dimethyltrideca-1,12-dien-4-yl] acetate |
| SMILES | CC(=O)O[C@H](CC[C@@H](C)C[C@@H](C)[C@H](C/C=C/Cl)OC(C)=O)C/C(=C\Cl)Cc1ccccc1 |
| InChI | InChI=1S/C26H36Cl2O4/c1-19(15-20(2)26(11-8-14-27)32-22(4)30)12-13-25(31-21(3)29)17-24(18-28)16-23-9-6-5-7-10-23/h5-10,14,18-20,25-26H,11-13,15-17H2,1-4H3/b14-8+,24-18-/t19-,20-,25-,26+/m1/s1 |
| InChIKey | KZZHQROVUBIQFD-VXUDHDTCSA-N |
| XLogP | 7.19 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.48 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |