C23H24BBrF2I2N2O — CID 162666592
8-[4-(4-bromobutoxy)phenyl]-2,2-difluoro-5,11-diiodo-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 162666592) has the molecular formula C23H24BBrF2I2N2O and a molecular weight of 726.98 g/mol. Its IUPAC name is 8-[4-(4-bromobutoxy)phenyl]-2,2-difluoro-5,11-diiodo-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 8-[4-(4-bromobutoxy)phenyl]-2,2-difluoro-5,11-diiodo-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 162666592 |
| Molecular Formula | C23H24BBrF2I2N2O |
| Molecular Weight | 726.98 g/mol |
| Exact Mass | 725.92 |
| IUPAC Name | 8-[4-(4-bromobutoxy)phenyl]-2,2-difluoro-5,11-diiodo-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | CC1=C(I)C(C)=[N+]2C1=C(c1ccc(OCCCCBr)cc1)c1c(C)c(I)c(C)n1[B-]2(F)F |
| InChI | InChI=1S/C23H24BBrF2I2N2O/c1-13-20(28)15(3)30-22(13)19(17-7-9-18(10-8-17)32-12-6-5-11-25)23-14(2)21(29)16(4)31(23)24(30,26)27/h7-10H,5-6,11-12H2,1-4H3 |
| InChIKey | FFNDFSKTBVYYNM-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 17.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.98 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|