About 2-amino-5-(5-cyclopropyl-6-methyl-4-oxo-[1,3]oxazolo[4,5-c]quinolin-7-yl)benzonitrile
2-amino-5-(5-cyclopropyl-6-methyl-4-oxo-[1,3]oxazolo[4,5-c]quinolin-7-yl)benzonitrile (PubChem CID 162666616) has the molecular formula C21H16N4O2
and a molecular weight of 356.39 g/mol. Its IUPAC name is 2-amino-5-(5-cyclopropyl-6-methyl-4-oxo-[1,3]oxazolo[4,5-c]quinolin-7-yl)benzonitrile.
Molecular Properties
| Compound Name | 2-amino-5-(5-cyclopropyl-6-methyl-4-oxo-[1,3]oxazolo[4,5-c]quinolin-7-yl)benzonitrile |
| PubChem CID | 162666616 |
| Molecular Formula | C21H16N4O2 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 2-amino-5-(5-cyclopropyl-6-methyl-4-oxo-[1,3]oxazolo[4,5-c]quinolin-7-yl)benzonitrile |
| SMILES | Cc1c(-c2ccc(N)c(C#N)c2)ccc2c3ocnc3c(=O)n(C3CC3)c12 |
| InChI | InChI=1S/C21H16N4O2/c1-11-15(12-2-7-17(23)13(8-12)9-22)5-6-16-19(11)25(14-3-4-14)21(26)18-20(16)27-10-24-18/h2,5-8,10,14H,3-4,23H2,1H3 |
| InChIKey | MQPFBEMJPWYNGH-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 97.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-5-(5-cyclopropyl-6-methyl-4-oxo-[1,3]oxazolo[4,5-c]quinolin-7-yl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5-(5-cyclopropyl-6-methyl-4-oxo-[1,3]oxazolo[4,5-c]quinolin-7-yl)benzonitrile?
The IUPAC name of 2-amino-5-(5-cyclopropyl-6-methyl-4-oxo-[1,3]oxazolo[4,5-c]quinolin-7-yl)benzonitrile (CID 162666616) is 2-amino-5-(5-cyclopropyl-6-methyl-4-oxo-[1,3]oxazolo[4,5-c]quinolin-7-yl)benzonitrile.
What is the SMILES notation for 2-amino-5-(5-cyclopropyl-6-methyl-4-oxo-[1,3]oxazolo[4,5-c]quinolin-7-yl)benzonitrile?
The canonical SMILES for 2-amino-5-(5-cyclopropyl-6-methyl-4-oxo-[1,3]oxazolo[4,5-c]quinolin-7-yl)benzonitrile is Cc1c(-c2ccc(N)c(C#N)c2)ccc2c3ocnc3c(=O)n(C3CC3)c12.
What is the InChIKey of 2-amino-5-(5-cyclopropyl-6-methyl-4-oxo-[1,3]oxazolo[4,5-c]quinolin-7-yl)benzonitrile?
The InChIKey is MQPFBEMJPWYNGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16N4O2/c1-11-15(12-2-7-17(23)13(8-12)9-22)5-6-16-19(11)25(14-3-4-14)21(26)18-20(16)27-10-24-18/h2,5-8,10,14H,3-4,23H2,1H3.
What are the key properties of 2-amino-5-(5-cyclopropyl-6-methyl-4-oxo-[1,3]oxazolo[4,5-c]quinolin-7-yl)benzonitrile?
2-amino-5-(5-cyclopropyl-6-methyl-4-oxo-[1,3]oxazolo[4,5-c]quinolin-7-yl)benzonitrile has a molecular weight of 356.39 g/mol, XLogP of 3.91, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-(5-cyclopropyl-6-methyl-4-oxo-[1,3]oxazolo[4,5-c]quinolin-7-yl)benzonitrile is sourced from PubChem (CID 162666616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).