C16H17F3N4O4 — CID 162666658
N-methyl-N-[(7-methyl-2-nitro-5,6-dihydroimidazo[2,1-b][1,3]oxazin-7-yl)methyl]-4-(trifluoromethoxy)aniline (PubChem CID 162666658) has the molecular formula C16H17F3N4O4 and a molecular weight of 386.33 g/mol. Its IUPAC name is N-methyl-N-[(7-methyl-2-nitro-5,6-dihydroimidazo[2,1-b][1,3]oxazin-7-yl)methyl]-4-(trifluoromethoxy)aniline.
| Compound Name | N-methyl-N-[(7-methyl-2-nitro-5,6-dihydroimidazo[2,1-b][1,3]oxazin-7-yl)methyl]-4-(trifluoromethoxy)aniline |
|---|---|
| PubChem CID | 162666658 |
| Molecular Formula | C16H17F3N4O4 |
| Molecular Weight | 386.33 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | N-methyl-N-[(7-methyl-2-nitro-5,6-dihydroimidazo[2,1-b][1,3]oxazin-7-yl)methyl]-4-(trifluoromethoxy)aniline |
| SMILES | CN(CC1(C)CCn2cc([N+](=O)[O-])nc2O1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H17F3N4O4/c1-15(7-8-22-9-13(23(24)25)20-14(22)27-15)10-21(2)11-3-5-12(6-4-11)26-16(17,18)19/h3-6,9H,7-8,10H2,1-2H3 |
| InChIKey | LDFDHKPOQWHDJM-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 82.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.33 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|