C15H10N4 — CID 162666708
5-phenyl-3,7,8,13-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaene (PubChem CID 162666708) has the molecular formula C15H10N4 and a molecular weight of 246.27 g/mol. Its IUPAC name is 5-phenyl-3,7,8,13-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaene.
| Compound Name | 5-phenyl-3,7,8,13-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaene |
|---|---|
| PubChem CID | 162666708 |
| Molecular Formula | C15H10N4 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 5-phenyl-3,7,8,13-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaene |
| SMILES | c1ccc(-c2cnc3c4ncccc4nn3c2)cc1 |
| InChI | InChI=1S/C15H10N4/c1-2-5-11(6-3-1)12-9-17-15-14-13(7-4-8-16-14)18-19(15)10-12/h1-10H |
| InChIKey | SZDGQUQEBARNQO-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |