About 3-bromopyrimido[1,2-b]indazole
3-bromopyrimido[1,2-b]indazole (PubChem CID 162666717) has the molecular formula C10H6BrN3
and a molecular weight of 248.08 g/mol. Its IUPAC name is 3-bromopyrimido[1,2-b]indazole.
Molecular Properties
| Compound Name | 3-bromopyrimido[1,2-b]indazole |
| PubChem CID | 162666717 |
| Molecular Formula | C10H6BrN3 |
| Molecular Weight | 248.08 g/mol |
| Exact Mass | 246.97 |
| IUPAC Name | 3-bromopyrimido[1,2-b]indazole |
| SMILES | Brc1cnc2c3ccccc3nn2c1 |
| InChI | InChI=1S/C10H6BrN3/c11-7-5-12-10-8-3-1-2-4-9(8)13-14(10)6-7/h1-6H |
| InChIKey | JZKCBGXPKXEXNX-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.08 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-bromopyrimido[1,2-b]indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromopyrimido[1,2-b]indazole?
The IUPAC name of 3-bromopyrimido[1,2-b]indazole (CID 162666717) is 3-bromopyrimido[1,2-b]indazole.
What is the SMILES notation for 3-bromopyrimido[1,2-b]indazole?
The canonical SMILES for 3-bromopyrimido[1,2-b]indazole is Brc1cnc2c3ccccc3nn2c1.
What is the InChIKey of 3-bromopyrimido[1,2-b]indazole?
The InChIKey is JZKCBGXPKXEXNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6BrN3/c11-7-5-12-10-8-3-1-2-4-9(8)13-14(10)6-7/h1-6H.
What are the key properties of 3-bromopyrimido[1,2-b]indazole?
3-bromopyrimido[1,2-b]indazole has a molecular weight of 248.08 g/mol, XLogP of 2.64, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromopyrimido[1,2-b]indazole is sourced from PubChem (CID 162666717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).