C23H21N7O — CID 162666718
5-(1H-indazol-6-yl)-N-(4-morpholin-4-ylphenyl)-1H-imidazo[4,5-b]pyridin-7-amine (PubChem CID 162666718) has the molecular formula C23H21N7O and a molecular weight of 411.47 g/mol. Its IUPAC name is 5-(1H-indazol-6-yl)-N-(4-morpholin-4-ylphenyl)-1H-imidazo[4,5-b]pyridin-7-amine.
| Compound Name | 5-(1H-indazol-6-yl)-N-(4-morpholin-4-ylphenyl)-1H-imidazo[4,5-b]pyridin-7-amine |
|---|---|
| PubChem CID | 162666718 |
| Molecular Formula | C23H21N7O |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 5-(1H-indazol-6-yl)-N-(4-morpholin-4-ylphenyl)-1H-imidazo[4,5-b]pyridin-7-amine |
| SMILES | c1nc2nc(-c3ccc4cn[nH]c4c3)cc(Nc3ccc(N4CCOCC4)cc3)c2[nH]1 |
| InChI | InChI=1S/C23H21N7O/c1-2-16-13-26-29-20(16)11-15(1)19-12-21(22-23(28-19)25-14-24-22)27-17-3-5-18(6-4-17)30-7-9-31-10-8-30/h1-6,11-14H,7-10H2,(H,26,29)(H2,24,25,27,28) |
| InChIKey | MCZRDSMWHJDZIV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 94.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|