C17H19N5O3 — CID 162666784
16-(methylamino)-8,13-dioxa-1,15,18,21-tetrazatetracyclo[12.5.2.13,7.017,20]docosa-3(22),4,6,14,16,20-hexaen-19-one (PubChem CID 162666784) has the molecular formula C17H19N5O3 and a molecular weight of 341.37 g/mol. Its IUPAC name is 16-(methylamino)-8,13-dioxa-1,15,18,21-tetrazatetracyclo[12.5.2.13,7.017,20]docosa-3(22),4,6,14,16,20-hexaen-19-one.
| Compound Name | 16-(methylamino)-8,13-dioxa-1,15,18,21-tetrazatetracyclo[12.5.2.13,7.017,20]docosa-3(22),4,6,14,16,20-hexaen-19-one |
|---|---|
| PubChem CID | 162666784 |
| Molecular Formula | C17H19N5O3 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 16-(methylamino)-8,13-dioxa-1,15,18,21-tetrazatetracyclo[12.5.2.13,7.017,20]docosa-3(22),4,6,14,16,20-hexaen-19-one |
| SMILES | CNc1nc2nc3c1[nH]c(=O)n3Cc1cccc(c1)OCCCCO2 |
| InChI | InChI=1S/C17H19N5O3/c1-18-14-13-15-21-16(20-14)25-8-3-2-7-24-12-6-4-5-11(9-12)10-22(15)17(23)19-13/h4-6,9H,2-3,7-8,10H2,1H3,(H,19,23)(H,18,20,21) |
| InChIKey | BEGGDEBFOQWGAK-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |