C34H25BBrF2N3O2 — CID 162666849
11-bromo-2,2-difluoro-4,12-bis(4-methoxyphenyl)-6,10-diphenyl-3,8-diaza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 162666849) has the molecular formula C34H25BBrF2N3O2 and a molecular weight of 636.31 g/mol. Its IUPAC name is 11-bromo-2,2-difluoro-4,12-bis(4-methoxyphenyl)-6,10-diphenyl-3,8-diaza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 11-bromo-2,2-difluoro-4,12-bis(4-methoxyphenyl)-6,10-diphenyl-3,8-diaza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 162666849 |
| Molecular Formula | C34H25BBrF2N3O2 |
| Molecular Weight | 636.31 g/mol |
| Exact Mass | 635.12 |
| IUPAC Name | 11-bromo-2,2-difluoro-4,12-bis(4-methoxyphenyl)-6,10-diphenyl-3,8-diaza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | COc1ccc(C2=[N+]3C(=Nc4c(-c5ccccc5)cc(-c5ccc(OC)cc5)n4[B-]3(F)F)C(c3ccccc3)=C2Br)cc1 |
| InChI | InChI=1S/C34H25BBrF2N3O2/c1-42-26-17-13-23(14-18-26)29-21-28(22-9-5-3-6-10-22)33-39-34-30(24-11-7-4-8-12-24)31(36)32(41(34)35(37,38)40(29)33)25-15-19-27(43-2)20-16-25/h3-21H,1-2H3 |
| InChIKey | RFRQCSVECQLMMF-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 38.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.31 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|