About [2-[4-(1-adamantyl)phenyl]-1,3-thiazol-4-yl]methyl thiocyanate
[2-[4-(1-adamantyl)phenyl]-1,3-thiazol-4-yl]methyl thiocyanate (PubChem CID 162666888) has the molecular formula C21H22N2S2
and a molecular weight of 366.56 g/mol. Its IUPAC name is [2-[4-(1-adamantyl)phenyl]-1,3-thiazol-4-yl]methyl thiocyanate.
Molecular Properties
| Compound Name | [2-[4-(1-adamantyl)phenyl]-1,3-thiazol-4-yl]methyl thiocyanate |
| PubChem CID | 162666888 |
| Molecular Formula | C21H22N2S2 |
| Molecular Weight | 366.56 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | [2-[4-(1-adamantyl)phenyl]-1,3-thiazol-4-yl]methyl thiocyanate |
| SMILES | N#CSCc1csc(-c2ccc(C34CC5CC(CC(C5)C3)C4)cc2)n1 |
| InChI | InChI=1S/C21H22N2S2/c22-13-24-11-19-12-25-20(23-19)17-1-3-18(4-2-17)21-8-14-5-15(9-21)7-16(6-14)10-21/h1-4,12,14-16H,5-11H2 |
| InChIKey | BWAIMIIRLVMCMD-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.56 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze [2-[4-(1-adamantyl)phenyl]-1,3-thiazol-4-yl]methyl thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[4-(1-adamantyl)phenyl]-1,3-thiazol-4-yl]methyl thiocyanate?
The IUPAC name of [2-[4-(1-adamantyl)phenyl]-1,3-thiazol-4-yl]methyl thiocyanate (CID 162666888) is [2-[4-(1-adamantyl)phenyl]-1,3-thiazol-4-yl]methyl thiocyanate.
What is the SMILES notation for [2-[4-(1-adamantyl)phenyl]-1,3-thiazol-4-yl]methyl thiocyanate?
The canonical SMILES for [2-[4-(1-adamantyl)phenyl]-1,3-thiazol-4-yl]methyl thiocyanate is N#CSCc1csc(-c2ccc(C34CC5CC(CC(C5)C3)C4)cc2)n1.
What is the InChIKey of [2-[4-(1-adamantyl)phenyl]-1,3-thiazol-4-yl]methyl thiocyanate?
The InChIKey is BWAIMIIRLVMCMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N2S2/c22-13-24-11-19-12-25-20(23-19)17-1-3-18(4-2-17)21-8-14-5-15(9-21)7-16(6-14)10-21/h1-4,12,14-16H,5-11H2.
What are the key properties of [2-[4-(1-adamantyl)phenyl]-1,3-thiazol-4-yl]methyl thiocyanate?
[2-[4-(1-adamantyl)phenyl]-1,3-thiazol-4-yl]methyl thiocyanate has a molecular weight of 366.56 g/mol, XLogP of 5.99, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[4-(1-adamantyl)phenyl]-1,3-thiazol-4-yl]methyl thiocyanate is sourced from PubChem (CID 162666888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).